brianrockwellmeg

What was a Hoover blanket during the Great Depression, named for the president that people felt should be doing more to help?

A. a grain sack

B. a newspaper

C. the American flag

D. a tent in shantytown

What is the term which translates to "everything is in it's place" and refers to gathering all needed equipment and measured ingredients required for the recipe? 

  Question 15 options:

Mise en place 

Preparation station 

Prep

Pre-preparation 

Present perfect

Do you think President Johnson’s actions deserved to have him removed from office? Why or why not?

Choose the correct answer

Past perfect

Mathematics in the modern world

C= {x x is an odd number less than 9}, and

D= {x x is an even number less than 9}.

3. (A B)' - C

4. D-(B A)

Describe how oxygen and carbon dioxide are transported in the blood, and explain how their loading and unloading is affected by temperature, pH, BPG and PCO2

Which one of the following compounds is NOT soluble (will precipitate)

Which one of the following compounds is NOT soluble (will precipitate)

If the two following solutions were mixed and go through a double displacement reaction, what are the two products that are made

AgNO_3(aq) + MgCl_2(aq)

Write balanced NET IONIC equations for the following double replacement reactions that occur in water. Use the solubility chart rules to determine physical states.1. K2SO4+BaCl2?>KCl+BaSO42.Al(NO3)3+NaOH?>Al(OH)3+NaNO33.CaCl2+Na2CO3?>NaCl+CaCO34.Na2S+Pb(C2H3O2)2?>PbS+NaC2H3O25.H2SO4+NaOH?>Na2SO4+H2O6.Na2S+HCl?>H2S+NaCl7.K2CO3+HNO3?>H2O+CO2+KNO38.(NH4)2SO4+Ba(NO3)2?>NH4NO3+BaSO49.Ba(OH)2+H3PO4?>H2O+Ba3(PO4)2

For the following reactions please balance the equation and convert to a net ionic equation (see above) and give the correct physical state of each reactant and product in the net ionic equation ( s, l, g or aq), (net ionic equations may be reported in data and calculation section and need not be repeated here). (a) BaCl2 + Na3PO4 ---> Ba3(PO4)2 + NaCl (b) BaCl2 + Na2SO4 ---> BaSO4 + NaCl (c) BaCl2 + Na2CO3 ---> BaCO3 + NaCl (d) BaCl2 + Na2SO3 ---> BaSO3 + NaCl (e) BaSO3 + HNO3 ---> SO2 + H2O + Ba(NO3)2 (f) BaCO3 + HNO3 ---> CO2 + H2O + Ba(NO3)2 (g) Ba3(PO4)2 + HNO3 ---> H3PO4 + Ba(NO3)2 (h) AgNO3 + NaI ---> AgI + NaNO3 (i) AgNO3 + NaBr ---> AgBr + NaNO3 (j) AgNO3 + NaCl ---> AgCl + NaNO3 (k) NaI + Cl2 ---> I2 + NaCl (l) NaBr + Cl2 ---> Br2 + NaCl (m) 2NaNO3 + 2H2SO4 + 2FeSO4 ---> 2NO2 + Fe2(SO4)3 + 2H2O + Na2SO4 (n) 3NaNO2 + H2SO4 ---> 2NO + H2O + NaNO3 + Na2SO4 (o) 2NaNO2 + 2H2SO4 + 2FeSO4 ---> 2NO + Fe2(SO4)3 + 2H2O + Na2SO4 (p) H2SO4 + Na2CO3 ---> CO2 + Na2SO4 + H2O (q) H2SO4 + Na2SO3 ---> SO2 + Na2SO4 + H2O

Please can someone kindly tell me if aliens exist 

Barite mineral (BaSO4) is processed by heat fusion with soda ash (Na2CO3) followed by  leaching with water to produce BaCO3. The overall reaction is 
Na2CO3 + BaSO4 → Na2SO4 + BaCO3 
Mol. wt: 106 233 142 197 
The analysis shows the weight percent as: solid residue, 33.6% BaSO4 and 66.4% BaCO3; 
and soluble salts, 58.1% Na2SO4 and 41.9% Na2CO3. For the process, calculate: 
(a) The composition of the mix before fusion 
(b) The percent excess reactant 
(c) The degree of completion and extent of reaction

Evaluate ??_S z^2 dS,
where S is the part of the cone z = sqrt(x^2 + y^2) that liesinside the cylinder x^2 + y^2 = 9.

Given a text file in the given format

Write a java program using regular expressions to display data in the given format in another file in json format. The use of regular expressions is important because later on different kinds of data may be added. For information retrieval the use of regular expressions is essential.

ticket number,the type of order,currency used,store number ,description of the receipt ,date and paid or not is shown in the text file.